About ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate
ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate (PubChem CID 24625285) has the molecular formula C17H28N4O3
and a molecular weight of 336.44 g/mol. Its IUPAC name is ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate |
| PubChem CID | 24625285 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCc2c(C)nn(C)c2C)CC1 |
| InChI | InChI=1S/C17H28N4O3/c1-5-24-17(23)21-10-8-14(9-11-21)18-16(22)7-6-15-12(2)19-20(4)13(15)3/h14H,5-11H2,1-4H3,(H,18,22) |
| InChIKey | FUQJUMFMXCTZPN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate (CID 24625285) is ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate is CCOC(=O)N1CCC(NC(=O)CCc2c(C)nn(C)c2C)CC1.
What is the InChIKey of ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate?
The InChIKey is FUQJUMFMXCTZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O3/c1-5-24-17(23)21-10-8-14(9-11-21)18-16(22)7-6-15-12(2)19-20(4)13(15)3/h14H,5-11H2,1-4H3,(H,18,22).
What are the key properties of ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate?
ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate has a molecular weight of 336.44 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]piperidine-1-carboxylate is sourced from PubChem (CID 24625285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).