C22H32N2O3S — CID 24626058
2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[(2-piperidin-1-ylsulfonylphenyl)methyl]cyclopropane-1-carboxamide (PubChem CID 24626058) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[(2-piperidin-1-ylsulfonylphenyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[(2-piperidin-1-ylsulfonylphenyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 24626058 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[(2-piperidin-1-ylsulfonylphenyl)methyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)=CC1C(C(=O)NCc2ccccc2S(=O)(=O)N2CCCCC2)C1(C)C |
| InChI | InChI=1S/C22H32N2O3S/c1-16(2)14-18-20(22(18,3)4)21(25)23-15-17-10-6-7-11-19(17)28(26,27)24-12-8-5-9-13-24/h6-7,10-11,14,18,20H,5,8-9,12-13,15H2,1-4H3,(H,23,25) |
| InChIKey | RBEXDTPEKAUSES-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|