C15H13F3N2O3 — CID 2462607
N,5-dimethyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide (PubChem CID 2462607) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is N,5-dimethyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide.
| Compound Name | N,5-dimethyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2462607 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N,5-dimethyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)CC(=O)Nc2ccc(F)c(F)c2F)o1 |
| InChI | InChI=1S/C15H13F3N2O3/c1-8-3-6-11(23-8)15(22)20(2)7-12(21)19-10-5-4-9(16)13(17)14(10)18/h3-6H,7H2,1-2H3,(H,19,21) |
| InChIKey | RSUVRAHTNCUYOF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|