C16H15N3O2S3 — CID 2462611
3-acetamido-N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)propanamide (PubChem CID 2462611) has the molecular formula C16H15N3O2S3 and a molecular weight of 377.52 g/mol. Its IUPAC name is 3-acetamido-N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-acetamido-N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 2462611 |
| Molecular Formula | C16H15N3O2S3 |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 3-acetamido-N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)propanamide |
| SMILES | CC(=O)NCCC(=O)Nc1nc(-c2cccs2)c(-c2cccs2)s1 |
| InChI | InChI=1S/C16H15N3O2S3/c1-10(20)17-7-6-13(21)18-16-19-14(11-4-2-8-22-11)15(24-16)12-5-3-9-23-12/h2-5,8-9H,6-7H2,1H3,(H,17,20)(H,18,19,21) |
| InChIKey | ZTFQZLHIRVROMX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |