C18H14ClN3OS2 — CID 24626682
2-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-5-thiophen-2-yl-1,3,4-oxadiazole (PubChem CID 24626682) has the molecular formula C18H14ClN3OS2 and a molecular weight of 387.92 g/mol. Its IUPAC name is 2-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-5-thiophen-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 24626682 |
| Molecular Formula | C18H14ClN3OS2 |
| Molecular Weight | 387.92 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
| SMILES | Cc1ccc2cc(CSc3nnc(-c4cccs4)o3)c(Cl)nc2c1C |
| InChI | InChI=1S/C18H14ClN3OS2/c1-10-5-6-12-8-13(16(19)20-15(12)11(10)2)9-25-18-22-21-17(23-18)14-4-3-7-24-14/h3-8H,9H2,1-2H3 |
| InChIKey | KYCWSYJHWBDYMF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.92 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|