C19H22Cl2N2O5 — CID 24626704
1-[(2,2-dichlorocyclopropyl)methyl]-3-(3,4-dipropoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 24626704) has the molecular formula C19H22Cl2N2O5 and a molecular weight of 429.30 g/mol. Its IUPAC name is 1-[(2,2-dichlorocyclopropyl)methyl]-3-(3,4-dipropoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[(2,2-dichlorocyclopropyl)methyl]-3-(3,4-dipropoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 24626704 |
| Molecular Formula | C19H22Cl2N2O5 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-[(2,2-dichlorocyclopropyl)methyl]-3-(3,4-dipropoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | CCCOc1ccc(N2C(=O)C(=O)N(CC3CC3(Cl)Cl)C2=O)cc1OCCC |
| InChI | InChI=1S/C19H22Cl2N2O5/c1-3-7-27-14-6-5-13(9-15(14)28-8-4-2)23-17(25)16(24)22(18(23)26)11-12-10-19(12,20)21/h5-6,9,12H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | XXLVNZNBQNEZFD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|