C19H20N4O3S — CID 24627819
N-[1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-3-(2-nitroanilino)propanamide (PubChem CID 24627819) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-3-(2-nitroanilino)propanamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 24627819 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-3-(2-nitroanilino)propanamide |
| SMILES | CC(c1nc2ccccc2s1)N(C)C(=O)CCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O3S/c1-13(19-21-15-8-4-6-10-17(15)27-19)22(2)18(24)11-12-20-14-7-3-5-9-16(14)23(25)26/h3-10,13,20H,11-12H2,1-2H3 |
| InChIKey | RGXAYCMUUJKVTH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|