About N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide
N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 24628326) has the molecular formula C20H15BrN4O3S
and a molecular weight of 471.34 g/mol. Its IUPAC name is N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide.
Molecular Properties
| Compound Name | N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
| PubChem CID | 24628326 |
| Molecular Formula | C20H15BrN4O3S |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1nc(-c2ccco2)nc2sc(C(=O)NNC(=O)c3ccc(Br)cc3)c(C)c12 |
| InChI | InChI=1S/C20H15BrN4O3S/c1-10-15-11(2)22-17(14-4-3-9-28-14)23-20(15)29-16(10)19(27)25-24-18(26)12-5-7-13(21)8-6-12/h3-9H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | OSRWDSODJCNOFW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide?
The IUPAC name of N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide (CID 24628326) is N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide.
What is the SMILES notation for N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide?
The canonical SMILES for N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide is Cc1nc(-c2ccco2)nc2sc(C(=O)NNC(=O)c3ccc(Br)cc3)c(C)c12.
What is the InChIKey of N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide?
The InChIKey is OSRWDSODJCNOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BrN4O3S/c1-10-15-11(2)22-17(14-4-3-9-28-14)23-20(15)29-16(10)19(27)25-24-18(26)12-5-7-13(21)8-6-12/h3-9H,1-2H3,(H,24,26)(H,25,27).
What are the key properties of N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide?
N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide has a molecular weight of 471.34 g/mol, XLogP of 4.41, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-bromobenzoyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide is sourced from PubChem (CID 24628326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).