C18H16ClNO2S — CID 24629182
2-chloro-N,4-dimethyl-N-naphthalen-2-ylbenzenesulfonamide (PubChem CID 24629182) has the molecular formula C18H16ClNO2S and a molecular weight of 345.85 g/mol. Its IUPAC name is 2-chloro-N,4-dimethyl-N-naphthalen-2-ylbenzenesulfonamide.
| Compound Name | 2-chloro-N,4-dimethyl-N-naphthalen-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 24629182 |
| Molecular Formula | C18H16ClNO2S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-chloro-N,4-dimethyl-N-naphthalen-2-ylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClNO2S/c1-13-7-10-18(17(19)11-13)23(21,22)20(2)16-9-8-14-5-3-4-6-15(14)12-16/h3-12H,1-2H3 |
| InChIKey | OMAXTSZKUXHIPD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |