About 3-(3,4-dimethylphenyl)sulfanylpropanoic acid
3-(3,4-dimethylphenyl)sulfanylpropanoic acid (PubChem CID 2463167) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)sulfanylpropanoic acid.
Molecular Properties
| Compound Name | 3-(3,4-dimethylphenyl)sulfanylpropanoic acid |
| PubChem CID | 2463167 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-(3,4-dimethylphenyl)sulfanylpropanoic acid |
| SMILES | Cc1ccc(SCCC(=O)O)cc1C |
| InChI | InChI=1S/C11H14O2S/c1-8-3-4-10(7-9(8)2)14-6-5-11(12)13/h3-4,7H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | OVGUBQSJOHHQOX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-dimethylphenyl)sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylphenyl)sulfanylpropanoic acid?
The IUPAC name of 3-(3,4-dimethylphenyl)sulfanylpropanoic acid (CID 2463167) is 3-(3,4-dimethylphenyl)sulfanylpropanoic acid.
What is the SMILES notation for 3-(3,4-dimethylphenyl)sulfanylpropanoic acid?
The canonical SMILES for 3-(3,4-dimethylphenyl)sulfanylpropanoic acid is Cc1ccc(SCCC(=O)O)cc1C.
What is the InChIKey of 3-(3,4-dimethylphenyl)sulfanylpropanoic acid?
The InChIKey is OVGUBQSJOHHQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-8-3-4-10(7-9(8)2)14-6-5-11(12)13/h3-4,7H,5-6H2,1-2H3,(H,12,13).
What are the key properties of 3-(3,4-dimethylphenyl)sulfanylpropanoic acid?
3-(3,4-dimethylphenyl)sulfanylpropanoic acid has a molecular weight of 210.30 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)sulfanylpropanoic acid is sourced from PubChem (CID 2463167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).