C26H33N3O2 — CID 24635319
N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide (PubChem CID 24635319) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 24635319 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)Cc1coc2cc(C)c(C(C)C)cc12 |
| InChI | InChI=1S/C26H33N3O2/c1-17(2)22-15-23-20(16-31-25(23)13-18(22)3)14-26(30)27-24-7-6-21(12-19(24)4)29-10-8-28(5)9-11-29/h6-7,12-13,15-17H,8-11,14H2,1-5H3,(H,27,30) |
| InChIKey | VPIQRHLNCKJJGA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|