C20H23N3O5S2 — CID 24635451
N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 24635451) has the molecular formula C20H23N3O5S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylacetamide.
| Compound Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 24635451 |
| Molecular Formula | C20H23N3O5S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2ccc([N+](=O)[O-])cc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H23N3O5S2/c1-15-5-6-16(13-19(15)30(27,28)22-11-3-2-4-12-22)21-20(24)14-29-18-9-7-17(8-10-18)23(25)26/h5-10,13H,2-4,11-12,14H2,1H3,(H,21,24) |
| InChIKey | OLJBPTACBZDXMZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|