C21H26FN3O4S — CID 24635519
N-[1-[3-(dimethylsulfamoyl)-4-methylanilino]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide (PubChem CID 24635519) has the molecular formula C21H26FN3O4S and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[1-[3-(dimethylsulfamoyl)-4-methylanilino]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[3-(dimethylsulfamoyl)-4-methylanilino]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 24635519 |
| Molecular Formula | C21H26FN3O4S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[1-[3-(dimethylsulfamoyl)-4-methylanilino]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
| SMILES | Cc1ccc(NC(=O)C(NC(=O)c2ccc(F)cc2)C(C)C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H26FN3O4S/c1-13(2)19(24-20(26)15-7-9-16(22)10-8-15)21(27)23-17-11-6-14(3)18(12-17)30(28,29)25(4)5/h6-13,19H,1-5H3,(H,23,27)(H,24,26) |
| InChIKey | KBDPAGRGBNKLOX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |