C25H26N2O5S — CID 24635981
(E)-3-(2,4-dimethylphenyl)-N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 24635981) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24635981 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2OC)cc1NC(=O)/C=C/c1ccc(C)cc1C |
| InChI | InChI=1S/C25H26N2O5S/c1-17-9-10-19(18(2)15-17)11-14-25(28)26-22-16-20(12-13-24(22)32-4)33(29,30)27-21-7-5-6-8-23(21)31-3/h5-16,27H,1-4H3,(H,26,28)/b14-11+ |
| InChIKey | GKEMGJARNAAYQQ-SDNWHVSQSA-N |
| XLogP | 4.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|