C22H25FN2O5S — CID 24636041
4-(4-fluorophenyl)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-oxobutanamide (PubChem CID 24636041) has the molecular formula C22H25FN2O5S and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-oxobutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 24636041 |
| Molecular Formula | C22H25FN2O5S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-oxobutanamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN2O5S/c1-30-21-11-9-18(31(28,29)25-13-3-2-4-14-25)15-19(21)24-22(27)12-10-20(26)16-5-7-17(23)8-6-16/h5-9,11,15H,2-4,10,12-14H2,1H3,(H,24,27) |
| InChIKey | AQWKGUQKESOMCE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |