C20H21ClN2O5 — CID 24636112
5-chloro-2-methoxy-N'-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]benzohydrazide (PubChem CID 24636112) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N'-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]benzohydrazide.
| Compound Name | 5-chloro-2-methoxy-N'-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24636112 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 5-chloro-2-methoxy-N'-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]benzohydrazide |
| SMILES | C/C=C/c1ccc(OCC(=O)NNC(=O)c2cc(Cl)ccc2OC)c(OC)c1 |
| InChI | InChI=1S/C20H21ClN2O5/c1-4-5-13-6-8-17(18(10-13)27-3)28-12-19(24)22-23-20(25)15-11-14(21)7-9-16(15)26-2/h4-11H,12H2,1-3H3,(H,22,24)(H,23,25)/b5-4+ |
| InChIKey | RROCXVWEGCDFSL-SNAWJCMRSA-N |
| XLogP | 3.23 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|