C19H20ClFN2O3S — CID 24636962
1-(4-chlorophenyl)sulfonyl-N-[(2-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 24636962) has the molecular formula C19H20ClFN2O3S and a molecular weight of 410.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[(2-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[(2-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24636962 |
| Molecular Formula | C19H20ClFN2O3S |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[(2-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1F)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H20ClFN2O3S/c20-16-7-9-17(10-8-16)27(25,26)23-11-3-5-15(13-23)19(24)22-12-14-4-1-2-6-18(14)21/h1-2,4,6-10,15H,3,5,11-13H2,(H,22,24) |
| InChIKey | OITSWCHGOARZGM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |