C21H26N6O2S — CID 24637224
1-[3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanoylamino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 24637224) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanoylamino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanoylamino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 24637224 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanoylamino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1nc2c3ccccc3nn2c(C)c1CCC(=O)NNC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C21H26N6O2S/c1-13-16(14(2)27-20(23-13)17-7-3-4-8-18(17)26-27)9-10-19(28)24-25-21(30)22-12-15-6-5-11-29-15/h3-4,7-8,15H,5-6,9-12H2,1-2H3,(H,24,28)(H2,22,25,30) |
| InChIKey | NJUADMIGXYZWNA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|