C15H20ClN3O3 — CID 24637788
N-[2-[[2-(tert-butylamino)-2-oxoethyl]amino]-2-oxoethyl]-3-chlorobenzamide (PubChem CID 24637788) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is N-[2-[[2-(tert-butylamino)-2-oxoethyl]amino]-2-oxoethyl]-3-chlorobenzamide.
| Compound Name | N-[2-[[2-(tert-butylamino)-2-oxoethyl]amino]-2-oxoethyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 24637788 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[2-[[2-(tert-butylamino)-2-oxoethyl]amino]-2-oxoethyl]-3-chlorobenzamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)CNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-15(2,3)19-13(21)9-17-12(20)8-18-14(22)10-5-4-6-11(16)7-10/h4-7H,8-9H2,1-3H3,(H,17,20)(H,18,22)(H,19,21) |
| InChIKey | OLBYFSQQELLAJF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |