C17H13N3O5S2 — CID 24641513
N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]-6-nitro-1,3-benzodioxole-5-carboxamide (PubChem CID 24641513) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]-6-nitro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]-6-nitro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 24641513 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]-6-nitro-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(CNC(=O)c3cc4c(cc3[N+](=O)[O-])OCO4)s2)cs1 |
| InChI | InChI=1S/C17H13N3O5S2/c1-9-19-12(7-26-9)16-3-2-10(27-16)6-18-17(21)11-4-14-15(25-8-24-14)5-13(11)20(22)23/h2-5,7H,6,8H2,1H3,(H,18,21) |
| InChIKey | GRGHEPMZBBQKKU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|