C22H27N5O4S2 — CID 24642911
N,N,1-trimethyl-2-[3-[2-[2-(4-methylphenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]benzimidazole-5-sulfonamide (PubChem CID 24642911) has the molecular formula C22H27N5O4S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is N,N,1-trimethyl-2-[3-[2-[2-(4-methylphenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]benzimidazole-5-sulfonamide.
| Compound Name | N,N,1-trimethyl-2-[3-[2-[2-(4-methylphenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 24642911 |
| Molecular Formula | C22H27N5O4S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N,N,1-trimethyl-2-[3-[2-[2-(4-methylphenyl)sulfanylacetyl]hydrazinyl]-3-oxopropyl]benzimidazole-5-sulfonamide |
| SMILES | Cc1ccc(SCC(=O)NNC(=O)CCc2nc3cc(S(=O)(=O)N(C)C)ccc3n2C)cc1 |
| InChI | InChI=1S/C22H27N5O4S2/c1-15-5-7-16(8-6-15)32-14-22(29)25-24-21(28)12-11-20-23-18-13-17(33(30,31)26(2)3)9-10-19(18)27(20)4/h5-10,13H,11-12,14H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | CDDMRWJZALPVGO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|