C20H21N5O2S — CID 24644050
1-[[4-oxo-4-(5-phenyl-3,4-dihydropyrazol-2-yl)butanoyl]amino]-3-phenylthiourea (PubChem CID 24644050) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-[[4-oxo-4-(5-phenyl-3,4-dihydropyrazol-2-yl)butanoyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[4-oxo-4-(5-phenyl-3,4-dihydropyrazol-2-yl)butanoyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 24644050 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-[[4-oxo-4-(5-phenyl-3,4-dihydropyrazol-2-yl)butanoyl]amino]-3-phenylthiourea |
| SMILES | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C20H21N5O2S/c26-18(22-23-20(28)21-16-9-5-2-6-10-16)11-12-19(27)25-14-13-17(24-25)15-7-3-1-4-8-15/h1-10H,11-14H2,(H,22,26)(H2,21,23,28) |
| InChIKey | TWWOQBHEQLKNNY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|