C21H24N6OS — CID 24644256
2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(3-indol-1-ylpropyl)acetamide (PubChem CID 24644256) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(3-indol-1-ylpropyl)acetamide.
| Compound Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(3-indol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 24644256 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(3-indol-1-ylpropyl)acetamide |
| SMILES | CSc1nc2nc(C)c(CC(=O)NCCCn3ccc4ccccc43)c(C)n2n1 |
| InChI | InChI=1S/C21H24N6OS/c1-14-17(15(2)27-20(23-14)24-21(25-27)29-3)13-19(28)22-10-6-11-26-12-9-16-7-4-5-8-18(16)26/h4-5,7-9,12H,6,10-11,13H2,1-3H3,(H,22,28) |
| InChIKey | HDIRFPJMABHNEX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|