C26H30N4O4 — CID 24644365
N'-[1-butyl-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]-1-methylindole-3-carbohydrazide (PubChem CID 24644365) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N'-[1-butyl-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]-1-methylindole-3-carbohydrazide.
| Compound Name | N'-[1-butyl-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 24644365 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N'-[1-butyl-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]-1-methylindole-3-carbohydrazide |
| SMILES | CCCCN1C(=O)CC(C(=O)NNC(=O)c2cn(C)c3ccccc23)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H30N4O4/c1-4-5-14-30-23(31)15-20(24(30)17-10-12-18(34-3)13-11-17)25(32)27-28-26(33)21-16-29(2)22-9-7-6-8-19(21)22/h6-13,16,20,24H,4-5,14-15H2,1-3H3,(H,27,32)(H,28,33) |
| InChIKey | ZCQZAMXXRZQHRW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|