C18H19N3O4 — CID 2464446
3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2464446) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2464446 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H19N3O4/c22-14-12-6-2-3-7-13(12)15(23)20(14)10-11-21-16(24)18(19-17(21)25)8-4-1-5-9-18/h2-3,6-7H,1,4-5,8-11H2,(H,19,25) |
| InChIKey | UCLSWAVVLGEKCW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|