C16H19N3O4S — CID 24644501
N-[[2-(methylsulfamoylmethyl)phenyl]methyl]-2-(2-oxo-1-pyridinyl)acetamide (PubChem CID 24644501) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[[2-(methylsulfamoylmethyl)phenyl]methyl]-2-(2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[[2-(methylsulfamoylmethyl)phenyl]methyl]-2-(2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 24644501 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[[2-(methylsulfamoylmethyl)phenyl]methyl]-2-(2-oxo-1-pyridinyl)acetamide |
| SMILES | CNS(=O)(=O)Cc1ccccc1CNC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C16H19N3O4S/c1-17-24(22,23)12-14-7-3-2-6-13(14)10-18-15(20)11-19-9-5-4-8-16(19)21/h2-9,17H,10-12H2,1H3,(H,18,20) |
| InChIKey | RWYLDRDMLWUTEQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |