C25H33N3O3 — CID 24644906
2-ethoxy-N-[3-methyl-1-[4-(3-methylphenyl)piperazin-1-yl]-1-oxobutan-2-yl]benzamide (PubChem CID 24644906) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-ethoxy-N-[3-methyl-1-[4-(3-methylphenyl)piperazin-1-yl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-ethoxy-N-[3-methyl-1-[4-(3-methylphenyl)piperazin-1-yl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 24644906 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 2-ethoxy-N-[3-methyl-1-[4-(3-methylphenyl)piperazin-1-yl]-1-oxobutan-2-yl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NC(C(=O)N1CCN(c2cccc(C)c2)CC1)C(C)C |
| InChI | InChI=1S/C25H33N3O3/c1-5-31-22-12-7-6-11-21(22)24(29)26-23(18(2)3)25(30)28-15-13-27(14-16-28)20-10-8-9-19(4)17-20/h6-12,17-18,23H,5,13-16H2,1-4H3,(H,26,29) |
| InChIKey | PPIVEYKYCMFCGT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |