About N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide
N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide (PubChem CID 24646128) has the molecular formula C19H29N3O4S
and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide |
| PubChem CID | 24646128 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide |
| SMILES | CC1CN(C(C)(C)CNC(=O)C(C)Sc2ccc([N+](=O)[O-])cc2)CC(C)O1 |
| InChI | InChI=1S/C19H29N3O4S/c1-13-10-21(11-14(2)26-13)19(4,5)12-20-18(23)15(3)27-17-8-6-16(7-9-17)22(24)25/h6-9,13-15H,10-12H2,1-5H3,(H,20,23) |
| InChIKey | MUBLQZYWCWLTRC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide?
The IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide (CID 24646128) is N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide.
What is the SMILES notation for N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide?
The canonical SMILES for N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide is CC1CN(C(C)(C)CNC(=O)C(C)Sc2ccc([N+](=O)[O-])cc2)CC(C)O1.
What is the InChIKey of N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide?
The InChIKey is MUBLQZYWCWLTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3O4S/c1-13-10-21(11-14(2)26-13)19(4,5)12-20-18(23)15(3)27-17-8-6-16(7-9-17)22(24)25/h6-9,13-15H,10-12H2,1-5H3,(H,20,23).
What are the key properties of N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide?
N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide has a molecular weight of 395.53 g/mol, XLogP of 3.08, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-2-(4-nitrophenyl)sulfanylpropanamide is sourced from PubChem (CID 24646128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).