C25H27N3O4S — CID 24647204
3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpropanamide (PubChem CID 24647204) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpropanamide.
| Compound Name | 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpropanamide |
|---|---|
| PubChem CID | 24647204 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 3-(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpropanamide |
| SMILES | O=C(CCc1nc2sc3c(c2c(=O)[nH]1)CCCC3)Nc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C25H27N3O4S/c29-21(26-15-8-9-17-18(14-15)32-25(31-17)12-4-1-5-13-25)11-10-20-27-23(30)22-16-6-2-3-7-19(16)33-24(22)28-20/h8-9,14H,1-7,10-13H2,(H,26,29)(H,27,28,30) |
| InChIKey | STLIXTMKTQUASY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |