C19H16IN3O3 — CID 24648594
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(3-iodo-4-methylphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 24648594) has the molecular formula C19H16IN3O3 and a molecular weight of 461.26 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(3-iodo-4-methylphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(3-iodo-4-methylphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 24648594 |
| Molecular Formula | C19H16IN3O3 |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(3-iodo-4-methylphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cn[nH]c2-c2ccc3c(c2)OCCO3)cc1I |
| InChI | InChI=1S/C19H16IN3O3/c1-11-2-4-13(9-15(11)20)22-19(24)14-10-21-23-18(14)12-3-5-16-17(8-12)26-7-6-25-16/h2-5,8-10H,6-7H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | KAEBAGWIRQEOGC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|