C22H22N6O2S — CID 24649470
10-[3-oxo-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]propyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 24649470) has the molecular formula C22H22N6O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is 10-[3-oxo-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]propyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[3-oxo-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]propyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 24649470 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 10-[3-oxo-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]propyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | O=C(CCc1nc2sc3c(c2c(=O)[nH]1)CCC3)N1CCCC1c1nnc2ccccn12 |
| InChI | InChI=1S/C22H22N6O2S/c29-18(27-12-4-6-14(27)20-26-25-17-8-1-2-11-28(17)20)10-9-16-23-21(30)19-13-5-3-7-15(13)31-22(19)24-16/h1-2,8,11,14H,3-7,9-10,12H2,(H,23,24,30) |
| InChIKey | SMURGMUQMKXWCW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |