C20H22N6O2 — CID 24650028
3-[4-(4-benzylpiperazine-1-carbonyl)-5-methylpyrazol-1-yl]-1H-pyridazin-6-one (PubChem CID 24650028) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 3-[4-(4-benzylpiperazine-1-carbonyl)-5-methylpyrazol-1-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[4-(4-benzylpiperazine-1-carbonyl)-5-methylpyrazol-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 24650028 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-[4-(4-benzylpiperazine-1-carbonyl)-5-methylpyrazol-1-yl]-1H-pyridazin-6-one |
| SMILES | Cc1c(C(=O)N2CCN(Cc3ccccc3)CC2)cnn1-c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C20H22N6O2/c1-15-17(13-21-26(15)18-7-8-19(27)23-22-18)20(28)25-11-9-24(10-12-25)14-16-5-3-2-4-6-16/h2-8,13H,9-12,14H2,1H3,(H,23,27) |
| InChIKey | RFLCAJQKPWNCKX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |