C17H18F3N3O4S — CID 24650999
1-(4-sulfamoylphenyl)-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]urea (PubChem CID 24650999) has the molecular formula C17H18F3N3O4S and a molecular weight of 417.41 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]urea.
| Compound Name | 1-(4-sulfamoylphenyl)-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 24650999 |
| Molecular Formula | C17H18F3N3O4S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NCc2ccc(COCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H18F3N3O4S/c18-17(19,20)11-27-10-13-3-1-12(2-4-13)9-22-16(24)23-14-5-7-15(8-6-14)28(21,25)26/h1-8H,9-11H2,(H2,21,25,26)(H2,22,23,24) |
| InChIKey | NNUWFCKDUSCYLZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |