C17H15BrFNO4 — CID 24651307
methyl 3-bromo-4-[2-[(2-fluorophenyl)methylamino]-2-oxoethoxy]benzoate (PubChem CID 24651307) has the molecular formula C17H15BrFNO4 and a molecular weight of 396.21 g/mol. Its IUPAC name is methyl 3-bromo-4-[2-[(2-fluorophenyl)methylamino]-2-oxoethoxy]benzoate.
| Compound Name | methyl 3-bromo-4-[2-[(2-fluorophenyl)methylamino]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 24651307 |
| Molecular Formula | C17H15BrFNO4 |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | methyl 3-bromo-4-[2-[(2-fluorophenyl)methylamino]-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)NCc2ccccc2F)c(Br)c1 |
| InChI | InChI=1S/C17H15BrFNO4/c1-23-17(22)11-6-7-15(13(18)8-11)24-10-16(21)20-9-12-4-2-3-5-14(12)19/h2-8H,9-10H2,1H3,(H,20,21) |
| InChIKey | NCKMPBDYPWSDCT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |