C20H17N5O2S4 — CID 24652937
2-[[5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)ethanone (PubChem CID 24652937) has the molecular formula C20H17N5O2S4 and a molecular weight of 487.66 g/mol. Its IUPAC name is 2-[[5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)ethanone.
| Compound Name | 2-[[5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 24652937 |
| Molecular Formula | C20H17N5O2S4 |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | 2-[[5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)ethanone |
| SMILES | Cc1nc(C)c(-c2nnc(SCC(=O)N3N=C(c4cccs4)CC3c3cccs3)o2)s1 |
| InChI | InChI=1S/C20H17N5O2S4/c1-11-18(31-12(2)21-11)19-22-23-20(27-19)30-10-17(26)25-14(16-6-4-8-29-16)9-13(24-25)15-5-3-7-28-15/h3-8,14H,9-10H2,1-2H3 |
| InChIKey | VEGMGNNEMSSQEL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |