C14H13N5O — CID 24653404
N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 24653404) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 24653404 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | O=C(CCn1cncn1)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C14H13N5O/c20-14(6-8-19-10-15-9-17-19)18-13-5-1-4-12-11(13)3-2-7-16-12/h1-5,7,9-10H,6,8H2,(H,18,20) |
| InChIKey | UQECOXBSEIRJBO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |