About N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide
N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 24653404) has the molecular formula C14H13N5O
and a molecular weight of 267.29 g/mol. Its IUPAC name is N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide |
| PubChem CID | 24653404 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | O=C(CCn1cncn1)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C14H13N5O/c20-14(6-8-19-10-15-9-17-19)18-13-5-1-4-12-11(13)3-2-7-16-12/h1-5,7,9-10H,6,8H2,(H,18,20) |
| InChIKey | UQECOXBSEIRJBO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide?
The IUPAC name of N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide (CID 24653404) is N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide.
What is the SMILES notation for N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide?
The canonical SMILES for N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide is O=C(CCn1cncn1)Nc1cccc2ncccc12.
What is the InChIKey of N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide?
The InChIKey is UQECOXBSEIRJBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5O/c20-14(6-8-19-10-15-9-17-19)18-13-5-1-4-12-11(13)3-2-7-16-12/h1-5,7,9-10H,6,8H2,(H,18,20).
What are the key properties of N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide?
N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide has a molecular weight of 267.29 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-quinolin-5-yl-3-(1,2,4-triazol-1-yl)propanamide is sourced from PubChem (CID 24653404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).