About 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide
3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide (PubChem CID 24653934) has the molecular formula C21H23N5O2S
and a molecular weight of 409.52 g/mol. Its IUPAC name is 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide.
Molecular Properties
| Compound Name | 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide |
| PubChem CID | 24653934 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide |
| SMILES | CC(Nc1nc2ccccc2s1)C(=O)Nc1cc(C(N)=O)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H23N5O2S/c1-13(23-21-25-15-6-2-3-7-18(15)29-21)20(28)24-16-12-14(19(22)27)8-9-17(16)26-10-4-5-11-26/h2-3,6-9,12-13H,4-5,10-11H2,1H3,(H2,22,27)(H,23,25)(H,24,28) |
| InChIKey | UYAJAJQFVFCOTL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide?
The IUPAC name of 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide (CID 24653934) is 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide.
What is the SMILES notation for 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide?
The canonical SMILES for 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide is CC(Nc1nc2ccccc2s1)C(=O)Nc1cc(C(N)=O)ccc1N1CCCC1.
What is the InChIKey of 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide?
The InChIKey is UYAJAJQFVFCOTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5O2S/c1-13(23-21-25-15-6-2-3-7-18(15)29-21)20(28)24-16-12-14(19(22)27)8-9-17(16)26-10-4-5-11-26/h2-3,6-9,12-13H,4-5,10-11H2,1H3,(H2,22,27)(H,23,25)(H,24,28).
What are the key properties of 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide?
3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide has a molecular weight of 409.52 g/mol, XLogP of 3.43, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]-4-pyrrolidin-1-ylbenzamide is sourced from PubChem (CID 24653934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).