C16H20N4S2 — CID 2465482
2-[[(2S,6S)-2,6-dimethylpiperidin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione (PubChem CID 2465482) has the molecular formula C16H20N4S2 and a molecular weight of 332.50 g/mol. Its IUPAC name is 2-[[(2S,6S)-2,6-dimethylpiperidin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione.
| Compound Name | 2-[[(2S,6S)-2,6-dimethylpiperidin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
|---|---|
| PubChem CID | 2465482 |
| Molecular Formula | C16H20N4S2 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[[(2S,6S)-2,6-dimethylpiperidin-1-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
| SMILES | C[C@H]1CCC[C@H](C)N1Cn1nc2sc3ccccc3n2c1=S |
| InChI | InChI=1S/C16H20N4S2/c1-11-6-5-7-12(2)18(11)10-19-16(21)20-13-8-3-4-9-14(13)22-15(20)17-19/h3-4,8-9,11-12H,5-7,10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | BWDRHCSBSLPDTB-RYUDHWBXSA-N |
| XLogP | 4.30 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|