C19H23N5O2S — CID 24655010
4-methyl-2-oxo-N-(1,3,5-trimethylpyrazol-4-yl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 24655010) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-(1,3,5-trimethylpyrazol-4-yl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | 4-methyl-2-oxo-N-(1,3,5-trimethylpyrazol-4-yl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 24655010 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-methyl-2-oxo-N-(1,3,5-trimethylpyrazol-4-yl)-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)c1sc2nc3n(c(=O)c2c1C)CCCCC3 |
| InChI | InChI=1S/C19H23N5O2S/c1-10-14-18(20-13-8-6-5-7-9-24(13)19(14)26)27-16(10)17(25)21-15-11(2)22-23(4)12(15)3/h5-9H2,1-4H3,(H,21,25) |
| InChIKey | UPHDNBVSLHUGST-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |