C23H32N4O4S — CID 24656404
ethyl 1-ethyl-3-[[3-(morpholine-4-carbonyl)piperidin-1-yl]methyl]-2-sulfanylidenebenzimidazole-5-carboxylate (PubChem CID 24656404) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is ethyl 1-ethyl-3-[[3-(morpholine-4-carbonyl)piperidin-1-yl]methyl]-2-sulfanylidenebenzimidazole-5-carboxylate.
| Compound Name | ethyl 1-ethyl-3-[[3-(morpholine-4-carbonyl)piperidin-1-yl]methyl]-2-sulfanylidenebenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 24656404 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | ethyl 1-ethyl-3-[[3-(morpholine-4-carbonyl)piperidin-1-yl]methyl]-2-sulfanylidenebenzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CN1CCCC(C(=O)N3CCOCC3)C1)c(=S)n2CC |
| InChI | InChI=1S/C23H32N4O4S/c1-3-26-19-8-7-17(22(29)31-4-2)14-20(19)27(23(26)32)16-24-9-5-6-18(15-24)21(28)25-10-12-30-13-11-25/h7-8,14,18H,3-6,9-13,15-16H2,1-2H3 |
| InChIKey | RBOXYSCBFGOTRH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|