About N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide
N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide (PubChem CID 24658429) has the molecular formula C21H26N4O
and a molecular weight of 350.47 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide.
Molecular Properties
| Compound Name | N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide |
| PubChem CID | 24658429 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide |
| SMILES | Cc1nc2c3ccccc3nn2c(C)c1CCC(=O)N(C)C(C)C1CC1 |
| InChI | InChI=1S/C21H26N4O/c1-13-17(11-12-20(26)24(4)14(2)16-9-10-16)15(3)25-21(22-13)18-7-5-6-8-19(18)23-25/h5-8,14,16H,9-12H2,1-4H3 |
| InChIKey | HDOZGAOGZTVRGB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide?
The IUPAC name of N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide (CID 24658429) is N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide.
What is the SMILES notation for N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide?
The canonical SMILES for N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide is Cc1nc2c3ccccc3nn2c(C)c1CCC(=O)N(C)C(C)C1CC1.
What is the InChIKey of N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide?
The InChIKey is HDOZGAOGZTVRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O/c1-13-17(11-12-20(26)24(4)14(2)16-9-10-16)15(3)25-21(22-13)18-7-5-6-8-19(18)23-25/h5-8,14,16H,9-12H2,1-4H3.
What are the key properties of N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide?
N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide has a molecular weight of 350.47 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropylethyl)-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-methylpropanamide is sourced from PubChem (CID 24658429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).