C27H38N4O3 — CID 24658456
1,3-bis[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]urea (PubChem CID 24658456) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is 1,3-bis[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]urea.
| Compound Name | 1,3-bis[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]urea |
|---|---|
| PubChem CID | 24658456 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 1,3-bis[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]urea |
| SMILES | COc1cccc(C(CNC(=O)NCC(c2cccc(OC)c2)N2CCCC2)N2CCCC2)c1 |
| InChI | InChI=1S/C27H38N4O3/c1-33-23-11-7-9-21(17-23)25(30-13-3-4-14-30)19-28-27(32)29-20-26(31-15-5-6-16-31)22-10-8-12-24(18-22)34-2/h7-12,17-18,25-26H,3-6,13-16,19-20H2,1-2H3,(H2,28,29,32) |
| InChIKey | SNGSIJHWRULNGX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |