About 5-amino-3-methyl-1,2-thiazole-4-carboxylate
5-amino-3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 2465960) has the molecular formula C5H5N2O2S-
and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 5-amino-3-methyl-1,2-thiazole-4-carboxylate |
| PubChem CID | 2465960 |
| Molecular Formula | C5H5N2O2S- |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.01 |
| IUPAC Name | 5-amino-3-methyl-1,2-thiazole-4-carboxylate |
| SMILES | Cc1nsc(N)c1C(=O)[O-] |
| InChI | InChI=1S/C5H6N2O2S/c1-2-3(5(8)9)4(6)10-7-2/h6H2,1H3,(H,8,9)/p-1 |
| InChIKey | AQBUEVXOULPURO-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-3-methyl-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The IUPAC name of 5-amino-3-methyl-1,2-thiazole-4-carboxylate (CID 2465960) is 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
What is the SMILES notation for 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The canonical SMILES for 5-amino-3-methyl-1,2-thiazole-4-carboxylate is Cc1nsc(N)c1C(=O)[O-].
What is the InChIKey of 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The InChIKey is AQBUEVXOULPURO-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6N2O2S/c1-2-3(5(8)9)4(6)10-7-2/h6H2,1H3,(H,8,9)/p-1.
What are the key properties of 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
5-amino-3-methyl-1,2-thiazole-4-carboxylate has a molecular weight of 157.17 g/mol, XLogP of -0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-methyl-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 2465960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).