C28H26N4O2 — CID 24660627
1-benzyl-N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]indole-3-carboxamide (PubChem CID 24660627) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-benzyl-N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]indole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 24660627 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-benzyl-N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]indole-3-carboxamide |
| SMILES | COc1ccccc1C(NC(=O)c1cn(Cc2ccccc2)c2ccccc12)c1nccn1C |
| InChI | InChI=1S/C28H26N4O2/c1-31-17-16-29-27(31)26(22-13-7-9-15-25(22)34-2)30-28(33)23-19-32(18-20-10-4-3-5-11-20)24-14-8-6-12-21(23)24/h3-17,19,26H,18H2,1-2H3,(H,30,33) |
| InChIKey | LGRUVQGQKOSSQC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |