C18H18Cl2N2O4 — CID 24660712
2-(2,5-dichlorophenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]acetamide (PubChem CID 24660712) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 24660712 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[1-(furan-3-carbonyl)piperidin-4-yl]acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)NC1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C18H18Cl2N2O4/c19-13-1-2-15(20)16(9-13)26-11-17(23)21-14-3-6-22(7-4-14)18(24)12-5-8-25-10-12/h1-2,5,8-10,14H,3-4,6-7,11H2,(H,21,23) |
| InChIKey | ZZZNAAHSUCLNRY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |