C18H21NOS — CID 24660786
(2,5-dimethylthiophen-3-yl)-(4-phenylpiperidin-1-yl)methanone (PubChem CID 24660786) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-(4-phenylpiperidin-1-yl)methanone.
| Compound Name | (2,5-dimethylthiophen-3-yl)-(4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 24660786 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-(4-phenylpiperidin-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC(c3ccccc3)CC2)c(C)s1 |
| InChI | InChI=1S/C18H21NOS/c1-13-12-17(14(2)21-13)18(20)19-10-8-16(9-11-19)15-6-4-3-5-7-15/h3-7,12,16H,8-11H2,1-2H3 |
| InChIKey | SEXVMSBDESDPSM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |