C19H19N3O4S — CID 24660945
N-[2-(furan-2-carbonylamino)ethyl]-2-(4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 24660945) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[2-(furan-2-carbonylamino)ethyl]-2-(4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-(furan-2-carbonylamino)ethyl]-2-(4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24660945 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[2-(furan-2-carbonylamino)ethyl]-2-(4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(-c2nc(C)c(C(=O)NCCNC(=O)c3ccco3)s2)cc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-12-16(27-19(22-12)13-5-7-14(25-2)8-6-13)18(24)21-10-9-20-17(23)15-4-3-11-26-15/h3-8,11H,9-10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | LQMHYVFJUPJSBG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|