C14H12ClN5OS — CID 24661676
5-(2-chlorophenyl)-3-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2,4-oxadiazole (PubChem CID 24661676) has the molecular formula C14H12ClN5OS and a molecular weight of 333.80 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2,4-oxadiazole.
| Compound Name | 5-(2-chlorophenyl)-3-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 24661676 |
| Molecular Formula | C14H12ClN5OS |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 5-(2-chlorophenyl)-3-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,2,4-oxadiazole |
| SMILES | C=CCn1cnnc1SCc1noc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H12ClN5OS/c1-2-7-20-9-16-18-14(20)22-8-12-17-13(21-19-12)10-5-3-4-6-11(10)15/h2-6,9H,1,7-8H2 |
| InChIKey | YDVBZILXEGOYFE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|