C23H26F3N5O2S — CID 24661933
N-[2-[[5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 24661933) has the molecular formula C23H26F3N5O2S and a molecular weight of 493.56 g/mol. Its IUPAC name is N-[2-[[5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 24661933 |
| Molecular Formula | C23H26F3N5O2S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[2-[[5,6-dimethyl-2-(morpholin-4-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1sc2nc(CN3CCOCC3)nc(NCCNC(=O)c3ccc(C(F)(F)F)cc3)c2c1C |
| InChI | InChI=1S/C23H26F3N5O2S/c1-14-15(2)34-22-19(14)20(29-18(30-22)13-31-9-11-33-12-10-31)27-7-8-28-21(32)16-3-5-17(6-4-16)23(24,25)26/h3-6H,7-13H2,1-2H3,(H,28,32)(H,27,29,30) |
| InChIKey | GLRWKWQVQCGUIB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|