About N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide
N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide (PubChem CID 24662133) has the molecular formula C20H19Cl2N3O3S
and a molecular weight of 452.36 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide |
| PubChem CID | 24662133 |
| Molecular Formula | C20H19Cl2N3O3S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O3S/c1-2-3-4-14-5-7-15(8-6-14)24-29(27,28)17-11-9-16(10-12-17)25-20(26)19(22)18(21)13-23-25/h5-13,24H,2-4H2,1H3 |
| InChIKey | CXGZCGQAVLDSRR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide?
The IUPAC name of N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide (CID 24662133) is N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide.
What is the SMILES notation for N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide?
The canonical SMILES for N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide is CCCCc1ccc(NS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)cc1.
What is the InChIKey of N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide?
The InChIKey is CXGZCGQAVLDSRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2N3O3S/c1-2-3-4-14-5-7-15(8-6-14)24-29(27,28)17-11-9-16(10-12-17)25-20(26)19(22)18(21)13-23-25/h5-13,24H,2-4H2,1H3.
What are the key properties of N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide?
N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide has a molecular weight of 452.36 g/mol, XLogP of 4.68, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butylphenyl)-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzenesulfonamide is sourced from PubChem (CID 24662133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).